C22H23N3O4 — CID 42727198
[1-(2,4-dimethylphenyl)-3-propan-2-ylpyrazol-5-yl] 4-methyl-3-nitrobenzoate (PubChem CID 42727198) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [1-(2,4-dimethylphenyl)-3-propan-2-ylpyrazol-5-yl] 4-methyl-3-nitrobenzoate.
| Compound Name | [1-(2,4-dimethylphenyl)-3-propan-2-ylpyrazol-5-yl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 42727198 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [1-(2,4-dimethylphenyl)-3-propan-2-ylpyrazol-5-yl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(-n2nc(C(C)C)cc2OC(=O)c2ccc(C)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-13(2)18-12-21(24(23-18)19-9-6-14(3)10-16(19)5)29-22(26)17-8-7-15(4)20(11-17)25(27)28/h6-13H,1-5H3 |
| InChIKey | CIRPFJFGYACJHL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|