C22H24N2O2 — CID 770801
[1-(2,4-dimethylphenyl)-3-propylpyrazol-5-yl] 4-methylbenzoate (PubChem CID 770801) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is [1-(2,4-dimethylphenyl)-3-propylpyrazol-5-yl] 4-methylbenzoate.
| Compound Name | [1-(2,4-dimethylphenyl)-3-propylpyrazol-5-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 770801 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [1-(2,4-dimethylphenyl)-3-propylpyrazol-5-yl] 4-methylbenzoate |
| SMILES | CCCc1cc(OC(=O)c2ccc(C)cc2)n(-c2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C22H24N2O2/c1-5-6-19-14-21(26-22(25)18-10-7-15(2)8-11-18)24(23-19)20-12-9-16(3)13-17(20)4/h7-14H,5-6H2,1-4H3 |
| InChIKey | PLTBXCFSERORHU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |