C22H24N2O4 — CID 1061772
[1-(4-methylphenyl)-3-propylpyrazol-5-yl] 3,5-dimethoxybenzoate (PubChem CID 1061772) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [1-(4-methylphenyl)-3-propylpyrazol-5-yl] 3,5-dimethoxybenzoate.
| Compound Name | [1-(4-methylphenyl)-3-propylpyrazol-5-yl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 1061772 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [1-(4-methylphenyl)-3-propylpyrazol-5-yl] 3,5-dimethoxybenzoate |
| SMILES | CCCc1cc(OC(=O)c2cc(OC)cc(OC)c2)n(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C22H24N2O4/c1-5-6-17-13-21(24(23-17)18-9-7-15(2)8-10-18)28-22(25)16-11-19(26-3)14-20(12-16)27-4/h7-14H,5-6H2,1-4H3 |
| InChIKey | GUHJJNZFTUIVRM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |