About [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate
[3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate (PubChem CID 42726698) has the molecular formula C22H24N2O3
and a molecular weight of 364.45 g/mol. Its IUPAC name is [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate.
Molecular Properties
| Compound Name | [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate |
| PubChem CID | 42726698 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)Oc2cc(COC)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-3-4-8-17-11-13-18(14-12-17)22(25)27-21-15-19(16-26-2)23-24(21)20-9-6-5-7-10-20/h5-7,9-15H,3-4,8,16H2,1-2H3 |
| InChIKey | RJBYPDHCGJIQHK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate?
The IUPAC name of [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate (CID 42726698) is [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate.
What is the SMILES notation for [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate?
The canonical SMILES for [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate is CCCCc1ccc(C(=O)Oc2cc(COC)nn2-c2ccccc2)cc1.
What is the InChIKey of [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate?
The InChIKey is RJBYPDHCGJIQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3/c1-3-4-8-17-11-13-18(14-12-17)22(25)27-21-15-19(16-26-2)23-24(21)20-9-6-5-7-10-20/h5-7,9-15H,3-4,8,16H2,1-2H3.
What are the key properties of [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate?
[3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate has a molecular weight of 364.45 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methoxymethyl)-1-phenylpyrazol-5-yl] 4-butylbenzoate is sourced from PubChem (CID 42726698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).