About [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate
[1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate (PubChem CID 42727023) has the molecular formula C21H21FN2O2
and a molecular weight of 352.41 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate.
Molecular Properties
| Compound Name | [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate |
| PubChem CID | 42727023 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate |
| SMILES | CCCc1cc(OC(=O)c2ccc(CC)cc2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H21FN2O2/c1-3-5-18-14-20(24(23-18)19-12-10-17(22)11-13-19)26-21(25)16-8-6-15(4-2)7-9-16/h6-14H,3-5H2,1-2H3 |
| InChIKey | PCUUKHFRONALNK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate?
The IUPAC name of [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate (CID 42727023) is [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate.
What is the SMILES notation for [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate?
The canonical SMILES for [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate is CCCc1cc(OC(=O)c2ccc(CC)cc2)n(-c2ccc(F)cc2)n1.
What is the InChIKey of [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate?
The InChIKey is PCUUKHFRONALNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FN2O2/c1-3-5-18-14-20(24(23-18)19-12-10-17(22)11-13-19)26-21(25)16-8-6-15(4-2)7-9-16/h6-14H,3-5H2,1-2H3.
What are the key properties of [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate?
[1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate has a molecular weight of 352.41 g/mol, XLogP of 4.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-fluorophenyl)-3-propylpyrazol-5-yl] 4-ethylbenzoate is sourced from PubChem (CID 42727023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).