About (2-formyl-4-nitrophenyl) 2-methylbenzoate
(2-formyl-4-nitrophenyl) 2-methylbenzoate (PubChem CID 4922391) has the molecular formula C15H11NO5
and a molecular weight of 285.25 g/mol. Its IUPAC name is (2-formyl-4-nitrophenyl) 2-methylbenzoate.
Molecular Properties
| Compound Name | (2-formyl-4-nitrophenyl) 2-methylbenzoate |
| PubChem CID | 4922391 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2-formyl-4-nitrophenyl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccc([N+](=O)[O-])cc1C=O |
| InChI | InChI=1S/C15H11NO5/c1-10-4-2-3-5-13(10)15(18)21-14-7-6-12(16(19)20)8-11(14)9-17/h2-9H,1H3 |
| InChIKey | ANHWCPKGGANWHO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-formyl-4-nitrophenyl) 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formyl-4-nitrophenyl) 2-methylbenzoate?
The IUPAC name of (2-formyl-4-nitrophenyl) 2-methylbenzoate (CID 4922391) is (2-formyl-4-nitrophenyl) 2-methylbenzoate.
What is the SMILES notation for (2-formyl-4-nitrophenyl) 2-methylbenzoate?
The canonical SMILES for (2-formyl-4-nitrophenyl) 2-methylbenzoate is Cc1ccccc1C(=O)Oc1ccc([N+](=O)[O-])cc1C=O.
What is the InChIKey of (2-formyl-4-nitrophenyl) 2-methylbenzoate?
The InChIKey is ANHWCPKGGANWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO5/c1-10-4-2-3-5-13(10)15(18)21-14-7-6-12(16(19)20)8-11(14)9-17/h2-9H,1H3.
What are the key properties of (2-formyl-4-nitrophenyl) 2-methylbenzoate?
(2-formyl-4-nitrophenyl) 2-methylbenzoate has a molecular weight of 285.25 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formyl-4-nitrophenyl) 2-methylbenzoate is sourced from PubChem (CID 4922391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).