About (2-formyl-4-nitrophenyl) 2-ethoxybenzoate
(2-formyl-4-nitrophenyl) 2-ethoxybenzoate (PubChem CID 23011376) has the molecular formula C16H13NO6
and a molecular weight of 315.28 g/mol. Its IUPAC name is (2-formyl-4-nitrophenyl) 2-ethoxybenzoate.
Molecular Properties
| Compound Name | (2-formyl-4-nitrophenyl) 2-ethoxybenzoate |
| PubChem CID | 23011376 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (2-formyl-4-nitrophenyl) 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)Oc1ccc([N+](=O)[O-])cc1C=O |
| InChI | InChI=1S/C16H13NO6/c1-2-22-15-6-4-3-5-13(15)16(19)23-14-8-7-12(17(20)21)9-11(14)10-18/h3-10H,2H2,1H3 |
| InChIKey | OYNZVEFDEUBWFY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-formyl-4-nitrophenyl) 2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formyl-4-nitrophenyl) 2-ethoxybenzoate?
The IUPAC name of (2-formyl-4-nitrophenyl) 2-ethoxybenzoate (CID 23011376) is (2-formyl-4-nitrophenyl) 2-ethoxybenzoate.
What is the SMILES notation for (2-formyl-4-nitrophenyl) 2-ethoxybenzoate?
The canonical SMILES for (2-formyl-4-nitrophenyl) 2-ethoxybenzoate is CCOc1ccccc1C(=O)Oc1ccc([N+](=O)[O-])cc1C=O.
What is the InChIKey of (2-formyl-4-nitrophenyl) 2-ethoxybenzoate?
The InChIKey is OYNZVEFDEUBWFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO6/c1-2-22-15-6-4-3-5-13(15)16(19)23-14-8-7-12(17(20)21)9-11(14)10-18/h3-10H,2H2,1H3.
What are the key properties of (2-formyl-4-nitrophenyl) 2-ethoxybenzoate?
(2-formyl-4-nitrophenyl) 2-ethoxybenzoate has a molecular weight of 315.28 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formyl-4-nitrophenyl) 2-ethoxybenzoate is sourced from PubChem (CID 23011376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).