C23H29N3O4 — CID 52920575
[(2E)-3,7-dimethylocta-2,6-dienyl] 1-(4-nitrophenyl)-3-propan-2-ylpyrazole-5-carboxylate (PubChem CID 52920575) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 1-(4-nitrophenyl)-3-propan-2-ylpyrazole-5-carboxylate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 1-(4-nitrophenyl)-3-propan-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 52920575 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 1-(4-nitrophenyl)-3-propan-2-ylpyrazole-5-carboxylate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)c1cc(C(C)C)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-16(2)7-6-8-18(5)13-14-30-23(27)22-15-21(17(3)4)24-25(22)19-9-11-20(12-10-19)26(28)29/h7,9-13,15,17H,6,8,14H2,1-5H3/b18-13+ |
| InChIKey | CHSUSWDWCXKNKB-QGOAFFKASA-N |
| XLogP | 5.75 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|