C26H25N3O5 — CID 141232102
[(2E)-3,7-dimethylocta-2,6-dienoyl] 1-(4-nitrophenyl)-3-phenylpyrazole-5-carboxylate (PubChem CID 141232102) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienoyl] 1-(4-nitrophenyl)-3-phenylpyrazole-5-carboxylate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienoyl] 1-(4-nitrophenyl)-3-phenylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 141232102 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienoyl] 1-(4-nitrophenyl)-3-phenylpyrazole-5-carboxylate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)OC(=O)c1cc(-c2ccccc2)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25N3O5/c1-18(2)8-7-9-19(3)16-25(30)34-26(31)24-17-23(20-10-5-4-6-11-20)27-28(24)21-12-14-22(15-13-21)29(32)33/h4-6,8,10-17H,7,9H2,1-3H3/b19-16+ |
| InChIKey | XYPXHGSLSKNWCL-KNTRCKAVSA-N |
| XLogP | 5.82 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|