C22H29N3O — CID 56649972
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,5-dimethyl-2-phenylpyrazole-3-carboxamide (PubChem CID 56649972) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,5-dimethyl-2-phenylpyrazole-3-carboxamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,5-dimethyl-2-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56649972 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,5-dimethyl-2-phenylpyrazole-3-carboxamide |
| SMILES | CC(C)=CCC/C(C)=C/CN(C)C(=O)c1cc(C)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H29N3O/c1-17(2)10-9-11-18(3)14-15-24(5)22(26)21-16-19(4)23-25(21)20-12-7-6-8-13-20/h6-8,10,12-14,16H,9,11,15H2,1-5H3/b18-14+ |
| InChIKey | FDFIOJHOSFLMEZ-NBVRZTHBSA-N |
| XLogP | 4.95 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|