C20H19N3O2 — CID 27666115
N-benzyl-N,6-dimethyl-4-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 27666115) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-benzyl-N,6-dimethyl-4-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-benzyl-N,6-dimethyl-4-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 27666115 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-benzyl-N,6-dimethyl-4-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)N(C)Cc2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c1-15-13-18(24)19(21-23(15)17-11-7-4-8-12-17)20(25)22(2)14-16-9-5-3-6-10-16/h3-13H,14H2,1-2H3 |
| InChIKey | SQPZVOJKAAJJOO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |