C18H24N2O4 — CID 102379340
[(2E,6E)-3,7-dimethyl-8-(4-nitroanilino)octa-2,6-dienyl] acetate (PubChem CID 102379340) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-8-(4-nitroanilino)octa-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-3,7-dimethyl-8-(4-nitroanilino)octa-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 102379340 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [(2E,6E)-3,7-dimethyl-8-(4-nitroanilino)octa-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-14(11-12-24-16(3)21)5-4-6-15(2)13-19-17-7-9-18(10-8-17)20(22)23/h6-11,19H,4-5,12-13H2,1-3H3/b14-11+,15-6+ |
| InChIKey | FNMHXWAGYPETJC-QQUWOELUSA-N |
| XLogP | 4.24 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|