C17H25NO4 — CID 13359126
1-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-4-nitrobenzene (PubChem CID 13359126) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-4-nitrobenzene.
| Compound Name | 1-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-4-nitrobenzene |
|---|---|
| PubChem CID | 13359126 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-4-nitrobenzene |
| SMILES | COC(C)(C)CCC/C(C)=C/COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H25NO4/c1-14(6-5-12-17(2,3)21-4)11-13-22-16-9-7-15(8-10-16)18(19)20/h7-11H,5-6,12-13H2,1-4H3/b14-11+ |
| InChIKey | CMWVDVGVRHVUMP-SDNWHVSQSA-N |
| XLogP | 4.52 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|