C12H19ClO2 — CID 10878979
[(2E,6E)-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate (PubChem CID 10878979) has the molecular formula C12H19ClO2 and a molecular weight of 230.73 g/mol. Its IUPAC name is [(2E,6E)-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 10878979 |
| Molecular Formula | C12H19ClO2 |
| Molecular Weight | 230.73 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [(2E,6E)-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CCl |
| InChI | InChI=1S/C12H19ClO2/c1-10(7-8-15-12(3)14)5-4-6-11(2)9-13/h6-7H,4-5,8-9H2,1-3H3/b10-7+,11-6+ |
| InChIKey | MMDKCCMNYBYSJC-NXAIOARDSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|