C24H38O6 — CID 162908539
[7-(acetyloxymethyl)-15-hydroxy-3,11,15-trimethyl-14-oxohexadeca-2,6,10-trienyl] acetate (PubChem CID 162908539) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is [7-(acetyloxymethyl)-15-hydroxy-3,11,15-trimethyl-14-oxohexadeca-2,6,10-trienyl] acetate.
| Compound Name | [7-(acetyloxymethyl)-15-hydroxy-3,11,15-trimethyl-14-oxohexadeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 162908539 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [7-(acetyloxymethyl)-15-hydroxy-3,11,15-trimethyl-14-oxohexadeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OCC=C(C)CCC=C(CCC=C(C)CCC(=O)C(C)(C)O)COC(C)=O |
| InChI | InChI=1S/C24H38O6/c1-18(13-14-23(27)24(5,6)28)9-7-11-22(17-30-21(4)26)12-8-10-19(2)15-16-29-20(3)25/h9,12,15,28H,7-8,10-11,13-14,16-17H2,1-6H3 |
| InChIKey | YPSGWPVFHZGFTP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|