C17H30O3 — CID 166505158
3,7,9-trimethyldeca-2,6-dienyl 2-hydroxy-2-methylpropanoate (PubChem CID 166505158) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 3,7,9-trimethyldeca-2,6-dienyl 2-hydroxy-2-methylpropanoate.
| Compound Name | 3,7,9-trimethyldeca-2,6-dienyl 2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 166505158 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 3,7,9-trimethyldeca-2,6-dienyl 2-hydroxy-2-methylpropanoate |
| SMILES | CC(=CCOC(=O)C(C)(C)O)CCC=C(C)CC(C)C |
| InChI | InChI=1S/C17H30O3/c1-13(2)12-15(4)9-7-8-14(3)10-11-20-16(18)17(5,6)19/h9-10,13,19H,7-8,11-12H2,1-6H3 |
| InChIKey | LTGZAQCUPXYBEW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|