C25H38O6 — CID 163184455
(2Z,6Z,10Z)-12-acetyloxy-6-(acetyloxymethyl)-10-methyl-2-(4-methyl-3-methylidenepentyl)dodeca-2,6,10-trienoic acid (PubChem CID 163184455) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is (2Z,6Z,10Z)-12-acetyloxy-6-(acetyloxymethyl)-10-methyl-2-(4-methyl-3-methylidenepentyl)dodeca-2,6,10-trienoic acid.
| Compound Name | (2Z,6Z,10Z)-12-acetyloxy-6-(acetyloxymethyl)-10-methyl-2-(4-methyl-3-methylidenepentyl)dodeca-2,6,10-trienoic acid |
|---|---|
| PubChem CID | 163184455 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (2Z,6Z,10Z)-12-acetyloxy-6-(acetyloxymethyl)-10-methyl-2-(4-methyl-3-methylidenepentyl)dodeca-2,6,10-trienoic acid |
| SMILES | C=C(CC/C(=C/CC/C(=C/CC/C(C)=C\COC(C)=O)COC(C)=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C25H38O6/c1-18(2)20(4)13-14-24(25(28)29)12-8-11-23(17-31-22(6)27)10-7-9-19(3)15-16-30-21(5)26/h10,12,15,18H,4,7-9,11,13-14,16-17H2,1-3,5-6H3,(H,28,29)/b19-15-,23-10-,24-12- |
| InChIKey | IRHJCFCBUBTOMP-ZVVWAPISSA-N |
| XLogP | 5.55 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|