C22H36O5 — CID 162866464
[(E,2Z,6S)-10-hydroxy-2-[(Z)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethyl-7-oxoundec-8-enyl] acetate (PubChem CID 162866464) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(E,2Z,6S)-10-hydroxy-2-[(Z)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethyl-7-oxoundec-8-enyl] acetate.
| Compound Name | [(E,2Z,6S)-10-hydroxy-2-[(Z)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethyl-7-oxoundec-8-enyl] acetate |
|---|---|
| PubChem CID | 162866464 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [(E,2Z,6S)-10-hydroxy-2-[(Z)-6-hydroxy-4-methylhex-4-enylidene]-6,10-dimethyl-7-oxoundec-8-enyl] acetate |
| SMILES | CC(=O)OC/C(=C\CC/C(C)=C\CO)CCC[C@H](C)C(=O)/C=C/C(C)(C)O |
| InChI | InChI=1S/C22H36O5/c1-17(13-15-23)8-6-10-20(16-27-19(3)24)11-7-9-18(2)21(25)12-14-22(4,5)26/h10,12-14,18,23,26H,6-9,11,15-16H2,1-5H3/b14-12+,17-13-,20-10-/t18-/m0/s1 |
| InChIKey | GMDVYBVDDTXBBB-HFGGDSHXSA-N |
| XLogP | 3.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|