C28H40O6 — CID 162881967
(1E,3R,6E,11R,13E)-3,15-dihydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-1,6,13-triene-5,12-dione (PubChem CID 162881967) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is (1E,3R,6E,11R,13E)-3,15-dihydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-1,6,13-triene-5,12-dione.
| Compound Name | (1E,3R,6E,11R,13E)-3,15-dihydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-1,6,13-triene-5,12-dione |
|---|---|
| PubChem CID | 162881967 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (1E,3R,6E,11R,13E)-3,15-dihydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-1,6,13-triene-5,12-dione |
| SMILES | COc1c(C)cc(O)cc1/C=C/[C@](C)(O)CC(=O)/C=C(\C)CCC[C@@H](C)C(=O)/C=C/C(C)(C)O |
| InChI | InChI=1S/C28H40O6/c1-19(9-8-10-20(2)25(31)12-13-27(4,5)32)15-24(30)18-28(6,33)14-11-22-17-23(29)16-21(3)26(22)34-7/h11-17,20,29,32-33H,8-10,18H2,1-7H3/b13-12+,14-11+,19-15+/t20-,28+/m1/s1 |
| InChIKey | KQMOBTZIZPBRGT-KHTUPFEYSA-N |
| XLogP | 5.08 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|