C28H42O5 — CID 5373289
(2E,6E)-15-hydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6-diene-5,12-dione (PubChem CID 5373289) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is (2E,6E)-15-hydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6-diene-5,12-dione.
| Compound Name | (2E,6E)-15-hydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6-diene-5,12-dione |
|---|---|
| PubChem CID | 5373289 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | (2E,6E)-15-hydroxy-1-(5-hydroxy-2-methoxy-3-methylphenyl)-3,7,11,15-tetramethylhexadeca-2,6-diene-5,12-dione |
| SMILES | COc1c(C)cc(O)cc1C/C=C(\C)CC(=O)/C=C(\C)CCCC(C)C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C28H42O5/c1-19(9-8-10-21(3)26(31)13-14-28(5,6)32)15-24(29)16-20(2)11-12-23-18-25(30)17-22(4)27(23)33-7/h11,15,17-18,21,30,32H,8-10,12-14,16H2,1-7H3/b19-15+,20-11+ |
| InChIKey | UMRDHAHRNXOABU-DVJXUAIHSA-N |
| XLogP | 6.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|