C29H44O5 — CID 74052779
13-(2,5-dimethoxy-3-methylphenyl)-1-(3,3-dimethyloxiran-2-yl)-9-hydroxy-3,7,11-trimethyltrideca-7,11-dien-2-one (PubChem CID 74052779) has the molecular formula C29H44O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is 13-(2,5-dimethoxy-3-methylphenyl)-1-(3,3-dimethyloxiran-2-yl)-9-hydroxy-3,7,11-trimethyltrideca-7,11-dien-2-one.
| Compound Name | 13-(2,5-dimethoxy-3-methylphenyl)-1-(3,3-dimethyloxiran-2-yl)-9-hydroxy-3,7,11-trimethyltrideca-7,11-dien-2-one |
|---|---|
| PubChem CID | 74052779 |
| Molecular Formula | C29H44O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 13-(2,5-dimethoxy-3-methylphenyl)-1-(3,3-dimethyloxiran-2-yl)-9-hydroxy-3,7,11-trimethyltrideca-7,11-dien-2-one |
| SMILES | COc1cc(C)c(OC)c(CC=C(C)CC(O)C=C(C)CCCC(C)C(=O)CC2OC2(C)C)c1 |
| InChI | InChI=1S/C29H44O5/c1-19(10-9-11-21(3)26(31)18-27-29(5,6)34-27)14-24(30)15-20(2)12-13-23-17-25(32-7)16-22(4)28(23)33-8/h12,14,16-17,21,24,27,30H,9-11,13,15,18H2,1-8H3 |
| InChIKey | KQKRQHLAQFACCF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|