C28H40O6 — CID 6481822
5-hydroxy-2-[(4Z,8E)-10-(5-hydroxy-2-methoxy-3-methylphenyl)-4,8-dimethyl-6-oxodeca-4,8-dienyl]-2,6,6-trimethyloxan-3-one (PubChem CID 6481822) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is 5-hydroxy-2-[(4Z,8E)-10-(5-hydroxy-2-methoxy-3-methylphenyl)-4,8-dimethyl-6-oxodeca-4,8-dienyl]-2,6,6-trimethyloxan-3-one.
| Compound Name | 5-hydroxy-2-[(4Z,8E)-10-(5-hydroxy-2-methoxy-3-methylphenyl)-4,8-dimethyl-6-oxodeca-4,8-dienyl]-2,6,6-trimethyloxan-3-one |
|---|---|
| PubChem CID | 6481822 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 5-hydroxy-2-[(4Z,8E)-10-(5-hydroxy-2-methoxy-3-methylphenyl)-4,8-dimethyl-6-oxodeca-4,8-dienyl]-2,6,6-trimethyloxan-3-one |
| SMILES | COc1c(C)cc(O)cc1C/C=C(\C)CC(=O)/C=C(/C)CCCC1(C)OC(C)(C)C(O)CC1=O |
| InChI | InChI=1S/C28H40O6/c1-18(9-8-12-28(6)25(32)17-24(31)27(4,5)34-28)13-22(29)14-19(2)10-11-21-16-23(30)15-20(3)26(21)33-7/h10,13,15-16,24,30-31H,8-9,11-12,14,17H2,1-7H3/b18-13-,19-10+ |
| InChIKey | PYJKLSJHTSUGQF-DZPGJBBUSA-N |
| XLogP | 5.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|