C27H38O5 — CID 163115244
1-(2,5-dihydroxy-3-methylphenyl)-13-(3,3-dimethyloxiran-2-yl)-12-hydroxy-3,7,11-trimethyltrideca-2,6,10-trien-5-one (PubChem CID 163115244) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-(2,5-dihydroxy-3-methylphenyl)-13-(3,3-dimethyloxiran-2-yl)-12-hydroxy-3,7,11-trimethyltrideca-2,6,10-trien-5-one.
| Compound Name | 1-(2,5-dihydroxy-3-methylphenyl)-13-(3,3-dimethyloxiran-2-yl)-12-hydroxy-3,7,11-trimethyltrideca-2,6,10-trien-5-one |
|---|---|
| PubChem CID | 163115244 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 1-(2,5-dihydroxy-3-methylphenyl)-13-(3,3-dimethyloxiran-2-yl)-12-hydroxy-3,7,11-trimethyltrideca-2,6,10-trien-5-one |
| SMILES | CC(=CC(=O)CC(C)=CCc1cc(O)cc(C)c1O)CCC=C(C)C(O)CC1OC1(C)C |
| InChI | InChI=1S/C27H38O5/c1-17(8-7-9-19(3)24(30)16-25-27(5,6)32-25)12-22(28)13-18(2)10-11-21-15-23(29)14-20(4)26(21)31/h9-10,12,14-15,24-25,29-31H,7-8,11,13,16H2,1-6H3 |
| InChIKey | XFVWZFWNPPFZHK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|