C27H38O6 — CID 163021208
1-(2,5-dihydroxy-3-methylphenyl)-11,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,13-triene-5,12-dione (PubChem CID 163021208) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-(2,5-dihydroxy-3-methylphenyl)-11,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,13-triene-5,12-dione.
| Compound Name | 1-(2,5-dihydroxy-3-methylphenyl)-11,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,13-triene-5,12-dione |
|---|---|
| PubChem CID | 163021208 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-(2,5-dihydroxy-3-methylphenyl)-11,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,13-triene-5,12-dione |
| SMILES | CC(=CC(=O)CC(C)=CCc1cc(O)cc(C)c1O)CCCC(C)(O)C(=O)C=CC(C)(C)O |
| InChI | InChI=1S/C27H38O6/c1-18(8-7-12-27(6,33)24(30)11-13-26(4,5)32)14-22(28)15-19(2)9-10-21-17-23(29)16-20(3)25(21)31/h9,11,13-14,16-17,29,31-33H,7-8,10,12,15H2,1-6H3 |
| InChIKey | HIAUAVCLJAHRLO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|