C22H30O5 — CID 162934739
(6E,10R,11E)-10-hydroxy-12-(5-hydroxy-2-methoxy-3-methylphenyl)-6,10-dimethyldodeca-6,11-diene-2,8-dione (PubChem CID 162934739) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (6E,10R,11E)-10-hydroxy-12-(5-hydroxy-2-methoxy-3-methylphenyl)-6,10-dimethyldodeca-6,11-diene-2,8-dione.
| Compound Name | (6E,10R,11E)-10-hydroxy-12-(5-hydroxy-2-methoxy-3-methylphenyl)-6,10-dimethyldodeca-6,11-diene-2,8-dione |
|---|---|
| PubChem CID | 162934739 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (6E,10R,11E)-10-hydroxy-12-(5-hydroxy-2-methoxy-3-methylphenyl)-6,10-dimethyldodeca-6,11-diene-2,8-dione |
| SMILES | COc1c(C)cc(O)cc1/C=C/[C@](C)(O)CC(=O)/C=C(\C)CCCC(C)=O |
| InChI | InChI=1S/C22H30O5/c1-15(7-6-8-17(3)23)11-20(25)14-22(4,26)10-9-18-13-19(24)12-16(2)21(18)27-5/h9-13,24,26H,6-8,14H2,1-5H3/b10-9+,15-11+/t22-/m0/s1 |
| InChIKey | DMSQHIJLAFYSCV-IEUWFWLSSA-N |
| XLogP | 4.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|