C13H15ClO2 — CID 83056822
(E)-1-chloro-4-(4-methoxy-3,5-dimethylphenyl)but-3-en-2-one (PubChem CID 83056822) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is (E)-1-chloro-4-(4-methoxy-3,5-dimethylphenyl)but-3-en-2-one.
| Compound Name | (E)-1-chloro-4-(4-methoxy-3,5-dimethylphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 83056822 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (E)-1-chloro-4-(4-methoxy-3,5-dimethylphenyl)but-3-en-2-one |
| SMILES | COc1c(C)cc(/C=C/C(=O)CCl)cc1C |
| InChI | InChI=1S/C13H15ClO2/c1-9-6-11(4-5-12(15)8-14)7-10(2)13(9)16-3/h4-7H,8H2,1-3H3/b5-4+ |
| InChIKey | CUWRMZSGIJLMET-SNAWJCMRSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|