C13H13O4- — CID 22134835
(E)-3-(4-acetyloxy-3,5-dimethylphenyl)prop-2-enoate (PubChem CID 22134835) has the molecular formula C13H13O4- and a molecular weight of 233.24 g/mol. Its IUPAC name is (E)-3-(4-acetyloxy-3,5-dimethylphenyl)prop-2-enoate.
| Compound Name | (E)-3-(4-acetyloxy-3,5-dimethylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 22134835 |
| Molecular Formula | C13H13O4- |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (E)-3-(4-acetyloxy-3,5-dimethylphenyl)prop-2-enoate |
| SMILES | CC(=O)Oc1c(C)cc(/C=C/C(=O)[O-])cc1C |
| InChI | InChI=1S/C13H14O4/c1-8-6-11(4-5-12(15)16)7-9(2)13(8)17-10(3)14/h4-7H,1-3H3,(H,15,16)/p-1/b5-4+ |
| InChIKey | QVBINQYEJHPBIH-SNAWJCMRSA-M |
| XLogP | 0.99 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|