C19H18O5 — CID 10019268
bis(4-formyl-2,6-dimethylphenyl) carbonate (PubChem CID 10019268) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is bis(4-formyl-2,6-dimethylphenyl) carbonate.
| Compound Name | bis(4-formyl-2,6-dimethylphenyl) carbonate |
|---|---|
| PubChem CID | 10019268 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | bis(4-formyl-2,6-dimethylphenyl) carbonate |
| SMILES | Cc1cc(C=O)cc(C)c1OC(=O)Oc1c(C)cc(C=O)cc1C |
| InChI | InChI=1S/C19H18O5/c1-11-5-15(9-20)6-12(2)17(11)23-19(22)24-18-13(3)7-16(10-21)8-14(18)4/h5-10H,1-4H3 |
| InChIKey | DHYKDXPVSYXYBK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|