C12H18O2Si — CID 102090063
3,5-dimethyl-4-trimethylsilyloxybenzaldehyde (PubChem CID 102090063) has the molecular formula C12H18O2Si and a molecular weight of 222.36 g/mol. Its IUPAC name is 3,5-dimethyl-4-trimethylsilyloxybenzaldehyde.
| Compound Name | 3,5-dimethyl-4-trimethylsilyloxybenzaldehyde |
|---|---|
| PubChem CID | 102090063 |
| Molecular Formula | C12H18O2Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3,5-dimethyl-4-trimethylsilyloxybenzaldehyde |
| SMILES | Cc1cc(C=O)cc(C)c1O[Si](C)(C)C |
| InChI | InChI=1S/C12H18O2Si/c1-9-6-11(8-13)7-10(2)12(9)14-15(3,4)5/h6-8H,1-5H3 |
| InChIKey | ARLHXZXUUYZZNQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|