About dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate
dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate (PubChem CID 102224738) has the molecular formula C18H21F3O5
and a molecular weight of 374.36 g/mol. Its IUPAC name is dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate |
| PubChem CID | 102224738 |
| Molecular Formula | C18H21F3O5 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate |
| SMILES | COC(=O)C(C/C=C/c1cc(C)c(OC)c(C)c1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C18H21F3O5/c1-11-9-13(10-12(2)14(11)24-3)7-6-8-17(15(22)25-4,16(23)26-5)18(19,20)21/h6-7,9-10H,8H2,1-5H3/b7-6+ |
| InChIKey | MKYNUPWOTHGZPS-VOTSOKGWSA-N |
| XLogP | 3.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate?
The IUPAC name of dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate (CID 102224738) is dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate.
What is the SMILES notation for dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate?
The canonical SMILES for dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate is COC(=O)C(C/C=C/c1cc(C)c(OC)c(C)c1)(C(=O)OC)C(F)(F)F.
What is the InChIKey of dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate?
The InChIKey is MKYNUPWOTHGZPS-VOTSOKGWSA-N. The full InChI is InChI=1S/C18H21F3O5/c1-11-9-13(10-12(2)14(11)24-3)7-6-8-17(15(22)25-4,16(23)26-5)18(19,20)21/h6-7,9-10H,8H2,1-5H3/b7-6+.
What are the key properties of dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate?
dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate has a molecular weight of 374.36 g/mol, XLogP of 3.61, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(E)-3-(4-methoxy-3,5-dimethylphenyl)prop-2-enyl]-2-(trifluoromethyl)propanedioate is sourced from PubChem (CID 102224738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).