C12H11F3O5S — CID 22134792
(E)-3-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid (PubChem CID 22134792) has the molecular formula C12H11F3O5S and a molecular weight of 324.28 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22134792 |
| Molecular Formula | C12H11F3O5S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)cc(C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O5S/c1-7-5-9(3-4-10(16)17)6-8(2)11(7)20-21(18,19)12(13,14)15/h3-6H,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | QSNVXZVFQJTBJT-ONEGZZNKSA-N |
| XLogP | 2.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|