C18H18O5S — CID 129452524
(E)-3-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid (PubChem CID 129452524) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 129452524 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C)cc(/C=C/C(=O)O)cc2C)cc1 |
| InChI | InChI=1S/C18H18O5S/c1-12-4-7-16(8-5-12)24(21,22)23-18-13(2)10-15(11-14(18)3)6-9-17(19)20/h4-11H,1-3H3,(H,19,20)/b9-6+ |
| InChIKey | YVZKQYSMFHICGF-RMKNXTFCSA-N |
| XLogP | 3.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|