C18H16O9S — CID 174480719
4-methoxycarbonyl-6-methyl-2-(4-methylphenyl)sulfonyloxybenzene-1,3-dicarboxylic acid (PubChem CID 174480719) has the molecular formula C18H16O9S and a molecular weight of 408.38 g/mol. Its IUPAC name is 4-methoxycarbonyl-6-methyl-2-(4-methylphenyl)sulfonyloxybenzene-1,3-dicarboxylic acid.
| Compound Name | 4-methoxycarbonyl-6-methyl-2-(4-methylphenyl)sulfonyloxybenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174480719 |
| Molecular Formula | C18H16O9S |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 4-methoxycarbonyl-6-methyl-2-(4-methylphenyl)sulfonyloxybenzene-1,3-dicarboxylic acid |
| SMILES | COC(=O)c1cc(C)c(C(=O)O)c(OS(=O)(=O)c2ccc(C)cc2)c1C(=O)O |
| InChI | InChI=1S/C18H16O9S/c1-9-4-6-11(7-5-9)28(24,25)27-15-13(16(19)20)10(2)8-12(18(23)26-3)14(15)17(21)22/h4-8H,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | KVNWYMSCNKUDOP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|