C17H16O6S — CID 23547442
2-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoacetic acid (PubChem CID 23547442) has the molecular formula C17H16O6S and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoacetic acid.
| Compound Name | 2-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 23547442 |
| Molecular Formula | C17H16O6S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[3,5-dimethyl-4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C)cc(C(=O)C(=O)O)cc2C)cc1 |
| InChI | InChI=1S/C17H16O6S/c1-10-4-6-14(7-5-10)24(21,22)23-16-11(2)8-13(9-12(16)3)15(18)17(19)20/h4-9H,1-3H3,(H,19,20) |
| InChIKey | GKGHSXDANOMJEV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|