C18H22O5S — CID 35297587
(2,4,6-trimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate (PubChem CID 35297587) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate.
| Compound Name | (2,4,6-trimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 35297587 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (2,4,6-trimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate |
| SMILES | COCCOc1ccc(S(=O)(=O)Oc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C18H22O5S/c1-13-11-14(2)18(15(3)12-13)23-24(19,20)17-7-5-16(6-8-17)22-10-9-21-4/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | WODDAUFWHAUUGU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|