C17H20O5S — CID 35294104
(3,5-dimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate (PubChem CID 35294104) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate.
| Compound Name | (3,5-dimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 35294104 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (3,5-dimethylphenyl) 4-(2-methoxyethoxy)benzenesulfonate |
| SMILES | COCCOc1ccc(S(=O)(=O)Oc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C17H20O5S/c1-13-10-14(2)12-16(11-13)22-23(18,19)17-6-4-15(5-7-17)21-9-8-20-3/h4-7,10-12H,8-9H2,1-3H3 |
| InChIKey | QEYBXLLUIWGYTP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|