C19H21N2O4S2+ — CID 90932017
[3-[3-(2-amino-1,3-thiazol-1-ium-1-yl)propoxy]-5-methylphenyl] benzenesulfonate (PubChem CID 90932017) has the molecular formula C19H21N2O4S2+ and a molecular weight of 405.52 g/mol. Its IUPAC name is [3-[3-(2-amino-1,3-thiazol-1-ium-1-yl)propoxy]-5-methylphenyl] benzenesulfonate.
| Compound Name | [3-[3-(2-amino-1,3-thiazol-1-ium-1-yl)propoxy]-5-methylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 90932017 |
| Molecular Formula | C19H21N2O4S2+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [3-[3-(2-amino-1,3-thiazol-1-ium-1-yl)propoxy]-5-methylphenyl] benzenesulfonate |
| SMILES | Cc1cc(OCCC[s+]2ccnc2N)cc(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H21N2O4S2/c1-15-12-16(24-9-5-10-26-11-8-21-19(26)20)14-17(13-15)25-27(22,23)18-6-3-2-4-7-18/h2-4,6-8,11-14H,5,9-10H2,1H3,(H2,20,21)/q+1 |
| InChIKey | DYVSCCICBCGLQM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|