C26H30Cl2O6S — CID 158855454
3-(3-chloropropoxy)-5-methylphenol;[3-(3-chloropropoxy)-5-methylphenyl] benzenesulfonate (PubChem CID 158855454) has the molecular formula C26H30Cl2O6S and a molecular weight of 541.49 g/mol. Its IUPAC name is 3-(3-chloropropoxy)-5-methylphenol;[3-(3-chloropropoxy)-5-methylphenyl] benzenesulfonate.
| Compound Name | 3-(3-chloropropoxy)-5-methylphenol;[3-(3-chloropropoxy)-5-methylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 158855454 |
| Molecular Formula | C26H30Cl2O6S |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 3-(3-chloropropoxy)-5-methylphenol;[3-(3-chloropropoxy)-5-methylphenyl] benzenesulfonate |
| SMILES | Cc1cc(O)cc(OCCCCl)c1.Cc1cc(OCCCCl)cc(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H17ClO4S.C10H13ClO2/c1-13-10-14(20-9-5-8-17)12-15(11-13)21-22(18,19)16-6-3-2-4-7-16;1-8-5-9(12)7-10(6-8)13-4-2-3-11/h2-4,6-7,10-12H,5,8-9H2,1H3;5-7,12H,2-4H2,1H3 |
| InChIKey | IZZJVUCNJNVYPX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|