C17H20ClN2O4S2+ — CID 58096351
[amino-[3-[3-(2-chlorophenyl)sulfonyloxy-5-methylphenoxy]propylsulfanyl]methylidene]azanium (PubChem CID 58096351) has the molecular formula C17H20ClN2O4S2+ and a molecular weight of 415.94 g/mol. Its IUPAC name is [amino-[3-[3-(2-chlorophenyl)sulfonyloxy-5-methylphenoxy]propylsulfanyl]methylidene]azanium.
| Compound Name | [amino-[3-[3-(2-chlorophenyl)sulfonyloxy-5-methylphenoxy]propylsulfanyl]methylidene]azanium |
|---|---|
| PubChem CID | 58096351 |
| Molecular Formula | C17H20ClN2O4S2+ |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [amino-[3-[3-(2-chlorophenyl)sulfonyloxy-5-methylphenoxy]propylsulfanyl]methylidene]azanium |
| SMILES | Cc1cc(OCCCSC(N)=[NH2+])cc(OS(=O)(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H19ClN2O4S2/c1-12-9-13(23-7-4-8-25-17(19)20)11-14(10-12)24-26(21,22)16-6-3-2-5-15(16)18/h2-3,5-6,9-11H,4,7-8H2,1H3,(H3,19,20)/p+1 |
| InChIKey | NPRLPEGFOKQTLC-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|