C17H20O6S — CID 22722465
[3-(3-hydroxypropoxy)-5-methylphenyl] 2-methoxybenzenesulfonate (PubChem CID 22722465) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methoxybenzenesulfonate.
| Compound Name | [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 22722465 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methoxybenzenesulfonate |
| SMILES | COc1ccccc1S(=O)(=O)Oc1cc(C)cc(OCCCO)c1 |
| InChI | InChI=1S/C17H20O6S/c1-13-10-14(22-9-5-8-18)12-15(11-13)23-24(19,20)17-7-4-3-6-16(17)21-2/h3-4,6-7,10-12,18H,5,8-9H2,1-2H3 |
| InChIKey | QAWYVGJELIINGP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|