C20H26N4O7S — CID 87874059
acetic acid;[3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2-methoxybenzenesulfonate (PubChem CID 87874059) has the molecular formula C20H26N4O7S and a molecular weight of 466.52 g/mol. Its IUPAC name is acetic acid;[3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2-methoxybenzenesulfonate.
| Compound Name | acetic acid;[3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 87874059 |
| Molecular Formula | C20H26N4O7S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | acetic acid;[3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2-methoxybenzenesulfonate |
| SMILES | CC(=O)O.[H]/N=C(\N)N(CCOc1cc(C)cc(OS(=O)(=O)c2ccccc2OC)c1)N=C |
| InChI | InChI=1S/C18H22N4O5S.C2H4O2/c1-13-10-14(26-9-8-22(21-2)18(19)20)12-15(11-13)27-28(23,24)17-7-5-4-6-16(17)25-3;1-2(3)4/h4-7,10-12H,2,8-9H2,1,3H3,(H3,19,20);1H3,(H,3,4) |
| InChIKey | GMEBHJWOKHDHBR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 164.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|