C19H25N5O7S — CID 87874204
[3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2,5-dimethylbenzenesulfonate;nitric acid (PubChem CID 87874204) has the molecular formula C19H25N5O7S and a molecular weight of 467.50 g/mol. Its IUPAC name is [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2,5-dimethylbenzenesulfonate;nitric acid.
| Compound Name | [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2,5-dimethylbenzenesulfonate;nitric acid |
|---|---|
| PubChem CID | 87874204 |
| Molecular Formula | C19H25N5O7S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 2,5-dimethylbenzenesulfonate;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N(CCOc1cc(C)cc(OS(=O)(=O)c2cc(C)ccc2C)c1)N=C |
| InChI | InChI=1S/C19H24N4O4S.HNO3/c1-13-5-6-15(3)18(11-13)28(24,25)27-17-10-14(2)9-16(12-17)26-8-7-23(22-4)19(20)21;2-1(3)4/h5-6,9-12H,4,7-8H2,1-3H3,(H3,20,21);(H,2,3,4) |
| InChIKey | PKGXDHXWUBDWRI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|