About 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide
2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide (PubChem CID 47090064) has the molecular formula C13H20N2O4S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide.
Molecular Properties
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide |
| PubChem CID | 47090064 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide |
| SMILES | COCCN(CC(N)=O)S(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C13H20N2O4S/c1-10-4-5-11(2)12(8-10)20(17,18)15(6-7-19-3)9-13(14)16/h4-5,8H,6-7,9H2,1-3H3,(H2,14,16) |
| InChIKey | GWPQPXLFFZMKNZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide?
The IUPAC name of 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide (CID 47090064) is 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide.
What is the SMILES notation for 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide?
The canonical SMILES for 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide is COCCN(CC(N)=O)S(=O)(=O)c1cc(C)ccc1C.
What is the InChIKey of 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide?
The InChIKey is GWPQPXLFFZMKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4S/c1-10-4-5-11(2)12(8-10)20(17,18)15(6-7-19-3)9-13(14)16/h4-5,8H,6-7,9H2,1-3H3,(H2,14,16).
What are the key properties of 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide?
2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide has a molecular weight of 300.38 g/mol, XLogP of 0.43, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide is sourced from PubChem (CID 47090064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).