C13H20N2O4S — CID 47090064
2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide (PubChem CID 47090064) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 47090064 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonyl-(2-methoxyethyl)amino]acetamide |
| SMILES | COCCN(CC(N)=O)S(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C13H20N2O4S/c1-10-4-5-11(2)12(8-10)20(17,18)15(6-7-19-3)9-13(14)16/h4-5,8H,6-7,9H2,1-3H3,(H2,14,16) |
| InChIKey | GWPQPXLFFZMKNZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |