C12H14F4N2O4S — CID 47090036
2-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-(2-methoxyethyl)amino]acetamide (PubChem CID 47090036) has the molecular formula C12H14F4N2O4S and a molecular weight of 358.31 g/mol. Its IUPAC name is 2-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-(2-methoxyethyl)amino]acetamide.
| Compound Name | 2-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-(2-methoxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 47090036 |
| Molecular Formula | C12H14F4N2O4S |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-(2-methoxyethyl)amino]acetamide |
| SMILES | COCCN(CC(N)=O)S(=O)(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F4N2O4S/c1-22-5-4-18(7-11(17)19)23(20,21)8-2-3-10(13)9(6-8)12(14,15)16/h2-3,6H,4-5,7H2,1H3,(H2,17,19) |
| InChIKey | YKMBEPUACPGDCY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |