C20H25NO4S — CID 32901189
[4-[butyl(methyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 32901189) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is [4-[butyl(methyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-[butyl(methyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 32901189 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [4-[butyl(methyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | CCCCN(C)C(=O)c1ccc(OS(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-5-6-13-21(4)20(22)17-9-11-18(12-10-17)25-26(23,24)19-14-15(2)7-8-16(19)3/h7-12,14H,5-6,13H2,1-4H3 |
| InChIKey | GLJZDICYCJSTRX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|