C18H19NO4S — CID 26641488
[4-(prop-2-enylcarbamoyl)phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 26641488) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [4-(prop-2-enylcarbamoyl)phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-(prop-2-enylcarbamoyl)phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 26641488 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [4-(prop-2-enylcarbamoyl)phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | C=CCNC(=O)c1ccc(OS(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-4-11-19-18(20)15-7-9-16(10-8-15)23-24(21,22)17-12-13(2)5-6-14(17)3/h4-10,12H,1,11H2,2-3H3,(H,19,20) |
| InChIKey | DPRZGAVICVWBMN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|