C22H19N3O7S — CID 26534154
[4-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 26534154) has the molecular formula C22H19N3O7S and a molecular weight of 469.48 g/mol. Its IUPAC name is [4-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 26534154 |
| Molecular Formula | C22H19N3O7S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | [4-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccc(C(=O)NNC(=O)c3cccc([N+](=O)[O-])c3)cc2)c1 |
| InChI | InChI=1S/C22H19N3O7S/c1-14-6-7-15(2)20(12-14)33(30,31)32-19-10-8-16(9-11-19)21(26)23-24-22(27)17-4-3-5-18(13-17)25(28)29/h3-13H,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | LUEBZIBTLZWIMZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|