C20H24N4O6S2 — CID 24539917
2,5-dimethyl-N-[4-methylsulfanyl-1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 24539917) has the molecular formula C20H24N4O6S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-methylsulfanyl-1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[4-methylsulfanyl-1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24539917 |
| Molecular Formula | C20H24N4O6S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2,5-dimethyl-N-[4-methylsulfanyl-1-[2-(3-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CSCCC(NS(=O)(=O)c1cc(C)ccc1C)C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N4O6S2/c1-13-7-8-14(2)18(11-13)32(29,30)23-17(9-10-31-3)20(26)22-21-19(25)15-5-4-6-16(12-15)24(27)28/h4-8,11-12,17,23H,9-10H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | SUSQNDXMZNJIKM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|