C22H26N4O4S2 — CID 24541315
N-[1-[2-(1H-indole-3-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2,5-dimethylbenzenesulfonamide (PubChem CID 24541315) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[1-[2-(1H-indole-3-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[1-[2-(1H-indole-3-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24541315 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[1-[2-(1H-indole-3-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2,5-dimethylbenzenesulfonamide |
| SMILES | CSCCC(NS(=O)(=O)c1cc(C)ccc1C)C(=O)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H26N4O4S2/c1-14-8-9-15(2)20(12-14)32(29,30)26-19(10-11-31-3)22(28)25-24-21(27)17-13-23-18-7-5-4-6-16(17)18/h4-9,12-13,19,23,26H,10-11H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | ATMPGDZAMKEZJS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|