C27H28N2O5S — CID 55776473
[4-[[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 55776473) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is [4-[[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-[[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 55776473 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [4-[[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccc(C(=O)Nc3cccc(C)c3C(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C27H28N2O5S/c1-18-9-10-19(2)24(17-18)35(32,33)34-22-13-11-21(12-14-22)26(30)28-23-8-6-7-20(3)25(23)27(31)29-15-4-5-16-29/h6-14,17H,4-5,15-16H2,1-3H3,(H,28,30) |
| InChIKey | QAKCUEZKTJDUIA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|